Click on the image to check the artwork
|
Product number |
PC00001 |
|
English Name |
3,4-Difluorobenzophenone |
|
CAS Number |
85118-07-6 |
|
Purity |
98% |
|
Molecular formula |
C13H8F2O |
|
Molecular weight |
218.19900 |
|
CB Number |
CB0750639 |
|
MDL Number |
MFCD00009892 |
|
Synonyms |
(3,4-difluorophenyl)-phenylmethanone |
|
Density |
1.49g/cm3 |
|
Melting point |
53-55 °C |
|
Boiling point |
402.6°C at 760 mmHg |
|
Flash Point |
113 |
|
Vapour Pressur |
3.33E-07mmHg at 25°C |
|
Storage temp |
Sealed in dry,Room Temperature |
|
Physical Form |
Solid |
|
Shipping Temperature |
Normal |
|
Appearance |
White to Light yellow to Light orange powder to crystal |
|
SMILES |
C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)F)F |
|
Remarks |
|
http://www.purestchem.com/